CAS 1203250-45-6 is the registry number for 2-Chloro-4-(1-methyl-1H-1,2,4-triazol-5-yl)pyrimidine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4-(2-methyl-1,2,4-triazol-3-yl)pyrimidine (CAS 1203250-45-6) is a chemical compound with the molecular formula C7H6ClN5 and a molecular weight of 195.61 g/mol. IUPAC name: 2-chloro-4-(2-methyl-1,2,4-triazol-3-yl)pyrimidine. InChIKey: HDWCFVNYZYORDT-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN5 |
|---|---|
| Molecular weight | 195.61 g/mol |
| IUPAC name | 2-chloro-4-(2-methyl-1,2,4-triazol-3-yl)pyrimidine |
| InChIKey | HDWCFVNYZYORDT-UHFFFAOYSA-N |
| SMILES | CN1C(=NC=N1)C2=NC(=NC=C2)Cl |
Computed by PubChem (NCBI)