CAS 168893-69-4 is the registry number for 5-(5-Chloro-2-pyridinyl)-1h-1,2,4-triazol-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-(5-chloro-2-pyridinyl)-1H-1,2,4-triazol-3-amine (CAS 168893-69-4) is a chemical compound with the molecular formula C7H6ClN5 and a molecular weight of 195.61 g/mol. IUPAC name: 5-(5-chloro-2-pyridinyl)-1H-1,2,4-triazol-3-amine. InChIKey: DACLQJIAJKLAIQ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN5 |
|---|---|
| Molecular weight | 195.61 g/mol |
| IUPAC name | 5-(5-chloro-2-pyridinyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | DACLQJIAJKLAIQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)C2=NC(=NN2)N |
Computed by PubChem (NCBI)