Products 2095840-88-1
CAS 2095840-88-1 appears in our catalog under these names: Tedizolid Impurity 75, Tedizolid Impurity 28, Tedizolid Impurity 60. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-chloro-2-(2-methyltetrazol-5-yl)pyridine (CAS 2095840-88-1) is a chemical compound with the molecular formula C7H6ClN5 and a molecular weight of 195.61 g/mol. IUPAC name: 5-chloro-2-(2-methyltetrazol-5-yl)pyridine. InChIKey: QSYXOBDXHRXPPX-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN5 |
|---|---|
| Molecular weight | 195.61 g/mol |
| IUPAC name | 5-chloro-2-(2-methyltetrazol-5-yl)pyridine |
| InChIKey | QSYXOBDXHRXPPX-UHFFFAOYSA-N |
| SMILES | CN1N=C(N=N1)C2=NC=C(C=C2)Cl |
Computed by PubChem (NCBI)