CAS 1247897-60-4 is the registry number for 4-Chloro-2-methyl-6-(1H-1,2,4-triazol-1-yl)pyrimidine, 98%. Offered by: AmBeed. Available pack sizes: 10g.
4-chloro-2-methyl-6-(1,2,4-triazol-1-yl)pyrimidine (CAS 1247897-60-4) is a chemical compound with the molecular formula C7H6ClN5 and a molecular weight of 195.61 g/mol. IUPAC name: 4-chloro-2-methyl-6-(1,2,4-triazol-1-yl)pyrimidine. InChIKey: QOJIMLYEYPEBMA-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN5 |
|---|---|
| Molecular weight | 195.61 g/mol |
| IUPAC name | 4-chloro-2-methyl-6-(1,2,4-triazol-1-yl)pyrimidine |
| InChIKey | QOJIMLYEYPEBMA-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=N1)Cl)N2C=NC=N2 |
Computed by PubChem (NCBI)