CAS 93684-07-2 appears in our catalog under these names: 6-Chloropyrido[3,2-d]pyrimidine-2,4-diamine, 95%, 6-Chloropyrido(3,2-d)pyrimidine-2,4-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
6-chloropyrido[3,2-d]pyrimidine-2,4-diamine (CAS 93684-07-2) is a chemical compound with the molecular formula C7H6ClN5 and a molecular weight of 195.61 g/mol. IUPAC name: 6-chloropyrido[3,2-d]pyrimidine-2,4-diamine. InChIKey: GNENAHOTYMCVSR-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN5 |
|---|---|
| Molecular weight | 195.61 g/mol |
| IUPAC name | 6-chloropyrido[3,2-d]pyrimidine-2,4-diamine |
| InChIKey | GNENAHOTYMCVSR-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=C(N=C2N)N)Cl |
Computed by PubChem (NCBI)