Products 120342-71-4

CAS 120342-71-4 is the registry number for N-(4-(1-Aminoethyl)phenyl)acetamide hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

N-[4-(1-aminoethyl)phenyl]acetamide;hydrochloride (CAS 120342-71-4) is a chemical compound with the molecular formula C10H15ClN2O and a molecular weight of 214.69 g/mol. IUPAC name: N-[4-(1-aminoethyl)phenyl]acetamide;hydrochloride. InChIKey: CJMAKPYPZQWWSK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15ClN2O
Molecular weight214.69 g/mol
IUPAC nameN-[4-(1-aminoethyl)phenyl]acetamide;hydrochloride
InChIKeyCJMAKPYPZQWWSK-UHFFFAOYSA-N
SMILESCC(C1=CC=C(C=C1)NC(=O)C)N.Cl

Computed by PubChem (NCBI)