Products 1203681-74-6

CAS 1203681-74-6 is the registry number for Methyl 3-(azetidin-3-yl)cyclohexane-1-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-(azetidin-3-yl)cyclohexane-1-carboxylate;hydrochloride (CAS 1203681-74-6) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: methyl 3-(azetidin-3-yl)cyclohexane-1-carboxylate;hydrochloride. InChIKey: ASVDALDKTBURQR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20ClNO2
Molecular weight233.73 g/mol
IUPAC namemethyl 3-(azetidin-3-yl)cyclohexane-1-carboxylate;hydrochloride
InChIKeyASVDALDKTBURQR-UHFFFAOYSA-N
SMILESCOC(=O)C1CCCC(C1)C2CNC2.Cl

Computed by PubChem (NCBI)