Products 1203683-81-1
CAS 1203683-81-1 appears in our catalog under these names: Azetidine, 3-(3-bromophenyl)-, hydrochloride, 97%, 3-(3-Bromophenyl)azetidine hydrochloride, 97%, 3-(3-bromophenyl)azetidine hcl, 3-(3-Bromophenyl)azetidine hydrochloride, 97%, 97%, 3-(3-BROMOPHENYL)AZETIDINE HCL, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 0,5g, 50mg, 500mg.
3-(3-bromophenyl)azetidine;hydrochloride (CAS 1203683-81-1) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: 3-(3-bromophenyl)azetidine;hydrochloride. InChIKey: NVZYTUNGTQYOOI-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | 3-(3-bromophenyl)azetidine;hydrochloride |
| InChIKey | NVZYTUNGTQYOOI-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=CC(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)