Products 120409-48-5

CAS 120409-48-5 is the registry number for 3-(Boc-amino)dihydrofuran-2,5-dione, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(2,5-dioxooxolan-3-yl)carbamate (CAS 120409-48-5) is a chemical compound with the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. IUPAC name: tert-butyl N-(2,5-dioxooxolan-3-yl)carbamate. InChIKey: NPSWWCAEJQQFGG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13NO5
Molecular weight215.20 g/mol
IUPAC nametert-butyl N-(2,5-dioxooxolan-3-yl)carbamate
InChIKeyNPSWWCAEJQQFGG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CC(=O)OC1=O

Computed by PubChem (NCBI)