Products 30750-74-4

CAS 30750-74-4 is the registry number for Boc-L-aspartic anhydride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(3S)-2,5-dioxooxolan-3-yl]carbamate (CAS 30750-74-4) is a chemical compound with the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. IUPAC name: tert-butyl N-[(3S)-2,5-dioxooxolan-3-yl]carbamate. InChIKey: NPSWWCAEJQQFGG-YFKPBYRVSA-N.

Identity
Molecular formulaC9H13NO5
Molecular weight215.20 g/mol
IUPAC nametert-butyl N-[(3S)-2,5-dioxooxolan-3-yl]carbamate
InChIKeyNPSWWCAEJQQFGG-YFKPBYRVSA-N
SMILESCC(C)(C)OC(=O)N[C@H]1CC(=O)OC1=O

Computed by PubChem (NCBI)