CAS 30750-74-4 is the registry number for Boc-L-aspartic anhydride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Tert-butyl N-[(3S)-2,5-dioxooxolan-3-yl]carbamate (CAS 30750-74-4) is a chemical compound with the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. IUPAC name: tert-butyl N-[(3S)-2,5-dioxooxolan-3-yl]carbamate. InChIKey: NPSWWCAEJQQFGG-YFKPBYRVSA-N.
| Molecular formula | C9H13NO5 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | tert-butyl N-[(3S)-2,5-dioxooxolan-3-yl]carbamate |
| InChIKey | NPSWWCAEJQQFGG-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC(=O)OC1=O |
Computed by PubChem (NCBI)