CAS 120420-51-1 is the registry number for Ethyl 6-chloro-2-methyl-4-oxo-1,4-dihydroquinoline-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 6-chloro-2-methyl-4-oxo-1H-quinoline-3-carboxylate (CAS 120420-51-1) is a chemical compound with the molecular formula C13H12ClNO3 and a molecular weight of 265.69 g/mol. IUPAC name: ethyl 6-chloro-2-methyl-4-oxo-1H-quinoline-3-carboxylate. InChIKey: GIOOKSRAWDTGPX-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO3 |
|---|---|
| Molecular weight | 265.69 g/mol |
| IUPAC name | ethyl 6-chloro-2-methyl-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | GIOOKSRAWDTGPX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC2=C(C1=O)C=C(C=C2)Cl)C |
Computed by PubChem (NCBI)