CAS 376591-97-8 appears in our catalog under these names: 3'-Amino-2'-hydroxy-[1,1'-biphenyl]-3-carboxylic acid hydrochloride, 95%, 3'-Amino-2'-hydroxy-(1,1'-biphenyl)-3-carboxylic acid hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
3-(3-amino-2-hydroxyphenyl)benzoic acid;hydrochloride (CAS 376591-97-8) is a chemical compound with the molecular formula C13H12ClNO3 and a molecular weight of 265.69 g/mol. IUPAC name: 3-(3-amino-2-hydroxyphenyl)benzoic acid;hydrochloride. InChIKey: HHPDYYCDILLKCD-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO3 |
|---|---|
| Molecular weight | 265.69 g/mol |
| IUPAC name | 3-(3-amino-2-hydroxyphenyl)benzoic acid;hydrochloride |
| InChIKey | HHPDYYCDILLKCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=C(C(=CC=C2)N)O.Cl |
Computed by PubChem (NCBI)