CAS 1225057-33-9 is the registry number for Ethyl 2-(2-chlorophenyl)-5-methyloxazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(2-chlorophenyl)-5-methyl-1,3-oxazole-4-carboxylate (CAS 1225057-33-9) is a chemical compound with the molecular formula C13H12ClNO3 and a molecular weight of 265.69 g/mol. IUPAC name: ethyl 2-(2-chlorophenyl)-5-methyl-1,3-oxazole-4-carboxylate. InChIKey: IERZFNHUUACNDC-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO3 |
|---|---|
| Molecular weight | 265.69 g/mol |
| IUPAC name | ethyl 2-(2-chlorophenyl)-5-methyl-1,3-oxazole-4-carboxylate |
| InChIKey | IERZFNHUUACNDC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC(=N1)C2=CC=CC=C2Cl)C |
Computed by PubChem (NCBI)