Products 64404-11-1

CAS 64404-11-1 is the registry number for 2-(1,3-Dioxo-1,3-dihydro-2h-isoindol-2-yl)-3-methylbutanoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoyl chloride (CAS 64404-11-1) is a chemical compound with the molecular formula C13H12ClNO3 and a molecular weight of 265.69 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoyl chloride. InChIKey: NCWARQGSAYOFNE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12ClNO3
Molecular weight265.69 g/mol
IUPAC name2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoyl chloride
InChIKeyNCWARQGSAYOFNE-UHFFFAOYSA-N
SMILESCC(C)C(C(=O)Cl)N1C(=O)C2=CC=CC=C2C1=O

Computed by PubChem (NCBI)