Products 2055119-31-6

CAS 2055119-31-6 is the registry number for 4-(4-Aminophenoxy)benzoic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

4-(4-aminophenoxy)benzoic acid;hydrochloride (CAS 2055119-31-6) is a chemical compound with the molecular formula C13H12ClNO3 and a molecular weight of 265.69 g/mol. IUPAC name: 4-(4-aminophenoxy)benzoic acid;hydrochloride. InChIKey: MJCLKGWFNIXYRG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12ClNO3
Molecular weight265.69 g/mol
IUPAC name4-(4-aminophenoxy)benzoic acid;hydrochloride
InChIKeyMJCLKGWFNIXYRG-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)O)OC2=CC=C(C=C2)N.Cl

Computed by PubChem (NCBI)