CAS 1204297-90-4 appears in our catalog under these names: 3-(4-fluorophenyl)pyrimidine-2,4(1H,3H)-dione, 97%, 3-(4-fluorophenyl)-1,2,3,4-tetrahydropyrimidine-2,4-dione, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g.
3-(4-fluorophenyl)-1H-pyrimidine-2,4-dione (CAS 1204297-90-4) is a chemical compound with the molecular formula C10H7FN2O2 and a molecular weight of 206.17 g/mol. IUPAC name: 3-(4-fluorophenyl)-1H-pyrimidine-2,4-dione. InChIKey: BMFGMMFYIDDQBZ-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O2 |
|---|---|
| Molecular weight | 206.17 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-1H-pyrimidine-2,4-dione |
| InChIKey | BMFGMMFYIDDQBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=CNC2=O)F |
Computed by PubChem (NCBI)