CAS 1204298-23-6 is the registry number for 3-(1,3-Dioxaindan-5-yl)-5-(chloromethyl)-1,3-oxazolidin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(1,3-benzodioxol-5-yl)-5-(chloromethyl)-1,3-oxazolidin-2-one (CAS 1204298-23-6) is a chemical compound with the molecular formula C11H10ClNO4 and a molecular weight of 255.65 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-yl)-5-(chloromethyl)-1,3-oxazolidin-2-one. InChIKey: BKYVFTGFXIPMCE-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO4 |
|---|---|
| Molecular weight | 255.65 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-yl)-5-(chloromethyl)-1,3-oxazolidin-2-one |
| InChIKey | BKYVFTGFXIPMCE-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)N1C2=CC3=C(C=C2)OCO3)CCl |
Computed by PubChem (NCBI)