CAS 1204315-47-8 is the registry number for Rel-4,4,5,5-tetramethyl-2-((1R,2S)-2-phenylcyclopropyl)-1,3,2-dioxaborolane, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4,4,5,5-tetramethyl-2-[(1R,2S)-2-phenylcyclopropyl]-1,3,2-dioxaborolane (CAS 1204315-47-8) is a chemical compound with the molecular formula C15H21BO2 and a molecular weight of 244.14 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(1R,2S)-2-phenylcyclopropyl]-1,3,2-dioxaborolane. InChIKey: UANSPBMADSQCLG-CHWSQXEVSA-N.
| Molecular formula | C15H21BO2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(1R,2S)-2-phenylcyclopropyl]-1,3,2-dioxaborolane |
| InChIKey | UANSPBMADSQCLG-CHWSQXEVSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)[C@@H]2C[C@@H]2C3=CC=CC=C3 |
Computed by PubChem (NCBI)