CAS 1204475-72-8 is the registry number for 3-methoxy-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methoxy-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS 1204475-72-8) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 3-methoxy-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid. InChIKey: ADABKILYVMTOFU-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 3-methoxy-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
| InChIKey | ADABKILYVMTOFU-UHFFFAOYSA-N |
| SMILES | COC1=C(NC2=C1C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)