Products 1204810-21-8
CAS 1204810-21-8 appears in our catalog under these names: 3-bromo-6-ethoxy-1,4-dihydroquinolin-4-one, 98%, 3-Bromo-6-Ethoxyquinolin-4-Ol, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-6-ethoxy-1H-quinolin-4-one (CAS 1204810-21-8) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: 3-bromo-6-ethoxy-1H-quinolin-4-one. InChIKey: BPWOTAUMTNBLFG-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 3-bromo-6-ethoxy-1H-quinolin-4-one |
| InChIKey | BPWOTAUMTNBLFG-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)NC=C(C2=O)Br |
Computed by PubChem (NCBI)