Products 1206593-29-4
CAS 1206593-29-4 appears in our catalog under these names: 4-Ethoxy-2-fluorobenzoic acid, 4-Ethoxy-2-fluorobenzoic acid, 95%, 4-Ethoxy-2-Fluorobenzoic acid 98%, 4-Ethoxy-2-fluorobenzoic acid, 98%, 98%. Offered by: Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
4-ethoxy-2-fluorobenzoic acid (CAS 1206593-29-4) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 4-ethoxy-2-fluorobenzoic acid. InChIKey: WVXNAAKJFTYOCN-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 4-ethoxy-2-fluorobenzoic acid |
| InChIKey | WVXNAAKJFTYOCN-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)C(=O)O)F |
Computed by PubChem (NCBI)