CAS 12068-03-0 is the registry number for Sodium methylbenzenesulfonate, 96%, 96%. Offered by: Chemat. Available pack sizes: 1g, 10g.
Sodium 4-methylbenzenesulfonate (CAS 12068-03-0) is a chemical compound with the molecular formula C7H7NaO3S and a molecular weight of 194.19 g/mol. IUPAC name: sodium 4-methylbenzenesulfonate. InChIKey: KVCGISUBCHHTDD-UHFFFAOYSA-M.
| Molecular formula | C7H7NaO3S |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | sodium 4-methylbenzenesulfonate |
| InChIKey | KVCGISUBCHHTDD-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)