CAS 1354960-71-6 appears in our catalog under these names: Sodium 2-hydroxy-2-(5-methylthiophen-2-yl)acetate, 95%, Sodium 2-hydroxy-2-(5-methylthiophen-2-yl)acetate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g, 50mg.
Sodium 2-hydroxy-2-(5-methylthiophen-2-yl)acetate (CAS 1354960-71-6) is a chemical compound with the molecular formula C7H7NaO3S and a molecular weight of 194.19 g/mol. IUPAC name: sodium 2-hydroxy-2-(5-methylthiophen-2-yl)acetate. InChIKey: IQKYHUBJJDEVHI-UHFFFAOYSA-M.
| Molecular formula | C7H7NaO3S |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | sodium 2-hydroxy-2-(5-methylthiophen-2-yl)acetate |
| InChIKey | IQKYHUBJJDEVHI-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(S1)C(C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)