CAS 15898-40-5 appears in our catalog under these names: Sodium 2-methoxybenzene-1-sulfinate 95%, Sodium 2-methoxybenzene-1-sulfinate, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Sodium 2-methoxybenzenesulfinate (CAS 15898-40-5) is a chemical compound with the molecular formula C7H7NaO3S and a molecular weight of 194.19 g/mol. IUPAC name: sodium 2-methoxybenzenesulfinate. InChIKey: YCXBFBQPNIPTLD-UHFFFAOYSA-M.
| Molecular formula | C7H7NaO3S |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | sodium 2-methoxybenzenesulfinate |
| InChIKey | YCXBFBQPNIPTLD-UHFFFAOYSA-M |
| SMILES | COC1=CC=CC=C1S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)