CAS 15898-41-6 appears in our catalog under these names: Sodium 3-methoxybenzenesulfinate, 97%, Sodium 3–methoxybenzenesulfinate. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100mg, 1g, 2,5g, 250mg, 50mg, 500mg.
Sodium 3-methoxybenzenesulfinate (CAS 15898-41-6) is a chemical compound with the molecular formula C7H7NaO3S and a molecular weight of 194.19 g/mol. IUPAC name: sodium 3-methoxybenzenesulfinate. InChIKey: CAKRNZFEHKYKLV-UHFFFAOYSA-M.
| Molecular formula | C7H7NaO3S |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | sodium 3-methoxybenzenesulfinate |
| InChIKey | CAKRNZFEHKYKLV-UHFFFAOYSA-M |
| SMILES | COC1=CC(=CC=C1)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)