CAS 57267-76-2 appears in our catalog under these names: Sodium phenylmethanesulfonate, 97%, Sodium phenylmethanesulfonate, Sodium phenylmethanesulfonate, 98%, 98%, Sodium phenylmethanesulfonate, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
Sodium phenylmethanesulfonate (CAS 57267-76-2) is a chemical compound with the molecular formula C7H7NaO3S and a molecular weight of 194.19 g/mol. IUPAC name: sodium phenylmethanesulfonate. InChIKey: YNBRSWNUNPAQOF-UHFFFAOYSA-M.
| Molecular formula | C7H7NaO3S |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | sodium phenylmethanesulfonate |
| InChIKey | YNBRSWNUNPAQOF-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)CS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)