CAS 1206905-48-7 appears in our catalog under these names: 7-Bromochroman-2-one, 98%, 7-Bromochroman-2-one, 98%, 98%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
7-bromo-3,4-dihydrochromen-2-one (CAS 1206905-48-7) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 7-bromo-3,4-dihydrochromen-2-one. InChIKey: DFCPFOHVVSSCNZ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 7-bromo-3,4-dihydrochromen-2-one |
| InChIKey | DFCPFOHVVSSCNZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)OC2=C1C=CC(=C2)Br |
Computed by PubChem (NCBI)