Products 1206969-12-1
CAS 1206969-12-1 is the registry number for 3-(3-Chlorophenyl)-1,2,4-thiadiazol-5(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
3-(3-chlorophenyl)-4H-1,2,4-thiadiazol-5-one (CAS 1206969-12-1) is a chemical compound with the molecular formula C8H5ClN2OS and a molecular weight of 212.66 g/mol. IUPAC name: 3-(3-chlorophenyl)-4H-1,2,4-thiadiazol-5-one. InChIKey: FDVVTENPZCGJGG-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2OS |
|---|---|
| Molecular weight | 212.66 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-4H-1,2,4-thiadiazol-5-one |
| InChIKey | FDVVTENPZCGJGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NSC(=O)N2 |
Computed by PubChem (NCBI)