CAS 55040-49-8 appears in our catalog under these names: 4-Chlorothieno(3,2-c)pyridine-7-carboxamide, 97%, 4-Chloro-thieno(3,2-c)pyridine-7-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
4-chlorothieno[3,2-c]pyridine-7-carboxamide (CAS 55040-49-8) is a chemical compound with the molecular formula C8H5ClN2OS and a molecular weight of 212.66 g/mol. IUPAC name: 4-chlorothieno[3,2-c]pyridine-7-carboxamide. InChIKey: ATSVIWBDZFVRNQ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2OS |
|---|---|
| Molecular weight | 212.66 g/mol |
| IUPAC name | 4-chlorothieno[3,2-c]pyridine-7-carboxamide |
| InChIKey | ATSVIWBDZFVRNQ-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C(=NC=C2C(=O)N)Cl |
Computed by PubChem (NCBI)