Products 691840-21-8
CAS 691840-21-8 appears in our catalog under these names: 3-(2-Chlorophenyl)-1,2,4-thiadiazol-5(4h)-one, 98%, 3-(2-CHlorophenyl)-1,2,4-thiadiazol-5(4h)-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
3-(2-chlorophenyl)-4H-1,2,4-thiadiazol-5-one (CAS 691840-21-8) is a chemical compound with the molecular formula C8H5ClN2OS and a molecular weight of 212.66 g/mol. IUPAC name: 3-(2-chlorophenyl)-4H-1,2,4-thiadiazol-5-one. InChIKey: NQYWTBZSDNPDLQ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2OS |
|---|---|
| Molecular weight | 212.66 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-4H-1,2,4-thiadiazol-5-one |
| InChIKey | NQYWTBZSDNPDLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NSC(=O)N2)Cl |
Computed by PubChem (NCBI)