CAS 203268-67-1 appears in our catalog under these names: 5-(4-Chlorophenyl)-1,3,4-oxadiazole-2-thiol, 97%, 5-(4-Chloro-phenyl)-[1,3,4]oxadiazole-2-thiol, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100mg.
5-(4-chlorophenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 203268-67-1) is a chemical compound with the molecular formula C8H5ClN2OS and a molecular weight of 212.66 g/mol. IUPAC name: 5-(4-chlorophenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: MUFWSGAENICYQA-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2OS |
|---|---|
| Molecular weight | 212.66 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | MUFWSGAENICYQA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=S)O2)Cl |
Computed by PubChem (NCBI)