Products 1690815-96-3
CAS 1690815-96-3 is the registry number for 6-Chloro-4-thiophen-2-yl-2h-pyridazin-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-chloro-5-thiophen-2-yl-1H-pyridazin-6-one (CAS 1690815-96-3) is a chemical compound with the molecular formula C8H5ClN2OS and a molecular weight of 212.66 g/mol. IUPAC name: 3-chloro-5-thiophen-2-yl-1H-pyridazin-6-one. InChIKey: CQSMOJWLAZKJHR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2OS |
|---|---|
| Molecular weight | 212.66 g/mol |
| IUPAC name | 3-chloro-5-thiophen-2-yl-1H-pyridazin-6-one |
| InChIKey | CQSMOJWLAZKJHR-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC(=NNC2=O)Cl |
Computed by PubChem (NCBI)