Products 1206970-04-8
CAS 1206970-04-8 appears in our catalog under these names: 1-(5-Chloro-6-methylbenzo[d]oxazol-2-yl)azetidine-3-carboxylic acid, 96%, 1-(5-CHloro-6-methylbenzo(d)oxazol-2-yl)azetidine-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
1-(5-chloro-6-methyl-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid (CAS 1206970-04-8) is a chemical compound with the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. IUPAC name: 1-(5-chloro-6-methyl-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid. InChIKey: SRCKBUQPKLTQGX-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O3 |
|---|---|
| Molecular weight | 266.68 g/mol |
| IUPAC name | 1-(5-chloro-6-methyl-1,3-benzoxazol-2-yl)azetidine-3-carboxylic acid |
| InChIKey | SRCKBUQPKLTQGX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Cl)N=C(O2)N3CC(C3)C(=O)O |
Computed by PubChem (NCBI)