CAS 439108-15-3 appears in our catalog under these names: 4-[3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoic acid, 95%, 4-(3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl)butanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoic acid (CAS 439108-15-3) is a chemical compound with the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. IUPAC name: 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoic acid. InChIKey: ROMPPAWVATWIKR-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O3 |
|---|---|
| Molecular weight | 266.68 g/mol |
| IUPAC name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]butanoic acid |
| InChIKey | ROMPPAWVATWIKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)CCCC(=O)O)Cl |
Computed by PubChem (NCBI)