Products 956786-68-8

CAS 956786-68-8 is the registry number for 3-[(4-Chloro-1h-pyrazol-1-yl)methyl]-4-methoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-[(4-chloropyrazol-1-yl)methyl]-4-methoxybenzoic acid (CAS 956786-68-8) is a chemical compound with the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. IUPAC name: 3-[(4-chloropyrazol-1-yl)methyl]-4-methoxybenzoic acid. InChIKey: ZXEXRYHAHMYZQW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11ClN2O3
Molecular weight266.68 g/mol
IUPAC name3-[(4-chloropyrazol-1-yl)methyl]-4-methoxybenzoic acid
InChIKeyZXEXRYHAHMYZQW-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(=O)O)CN2C=C(C=N2)Cl

Computed by PubChem (NCBI)