Products 2270907-90-7

CAS 2270907-90-7 is the registry number for 4-Chloro-2-(4-hydroxy-pyrazol-1-ylmethyl)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-chloro-2-[(4-hydroxypyrazol-1-yl)methyl]benzoate (CAS 2270907-90-7) is a chemical compound with the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. IUPAC name: methyl 4-chloro-2-[(4-hydroxypyrazol-1-yl)methyl]benzoate. InChIKey: HLHKKZAAYHITOE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11ClN2O3
Molecular weight266.68 g/mol
IUPAC namemethyl 4-chloro-2-[(4-hydroxypyrazol-1-yl)methyl]benzoate
InChIKeyHLHKKZAAYHITOE-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1)Cl)CN2C=C(C=N2)O

Computed by PubChem (NCBI)