CAS 726151-59-3 appears in our catalog under these names: 4-Chloro-2-(1,3-dihydro-benzoimidazol-2-ylidene)-3-oxo-butyric acid methyl ester, 95%, Methyl 4-chloro-2-(2,3-dihydro-1H-1,3-benzodiazol-2-ylidene)-3-oxobutanoate, 95%, Methyl 4-chloro-2-(2,3-dihydro-1H-1,3-benzodiazol-2-ylidene)-3-oxobutanoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 2,5g.
Methyl 2-(1H-benzimidazol-2-yl)-4-chloro-3-hydroxybut-2-enoate (CAS 726151-59-3) is a chemical compound with the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. IUPAC name: methyl 2-(1H-benzimidazol-2-yl)-4-chloro-3-hydroxybut-2-enoate. InChIKey: MWCAOEHFGSQZCU-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O3 |
|---|---|
| Molecular weight | 266.68 g/mol |
| IUPAC name | methyl 2-(1H-benzimidazol-2-yl)-4-chloro-3-hydroxybut-2-enoate |
| InChIKey | MWCAOEHFGSQZCU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=C(CCl)O)C1=NC2=CC=CC=C2N1 |
Computed by PubChem (NCBI)