Products 1207062-37-0
CAS 1207062-37-0 is the registry number for 2-Chloro-2-(4'-ethynylphenylhydrazono)acetic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl (2Z)-2-chloro-2-[(4-ethynylphenyl)hydrazinylidene]acetate (CAS 1207062-37-0) is a chemical compound with the molecular formula C12H11ClN2O2 and a molecular weight of 250.68 g/mol. IUPAC name: ethyl (2Z)-2-chloro-2-[(4-ethynylphenyl)hydrazinylidene]acetate. InChIKey: NBMDECYEQMXHQE-PTNGSMBKSA-N.
| Molecular formula | C12H11ClN2O2 |
|---|---|
| Molecular weight | 250.68 g/mol |
| IUPAC name | ethyl (2Z)-2-chloro-2-[(4-ethynylphenyl)hydrazinylidene]acetate |
| InChIKey | NBMDECYEQMXHQE-PTNGSMBKSA-N |
| SMILES | CCOC(=O)/C(=N/NC1=CC=C(C=C1)C#C)/Cl |
Computed by PubChem (NCBI)