CAS 1207448-48-3 appears in our catalog under these names: 4-Bromo-7-methoxyisoquinolin-1-ol, 98%, 4-Bromo-7-methoxy-1,2-dihydroisoquinolin-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
4-bromo-7-methoxy-2H-isoquinolin-1-one (CAS 1207448-48-3) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 4-bromo-7-methoxy-2H-isoquinolin-1-one. InChIKey: IUIGIHBFESJYRB-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 4-bromo-7-methoxy-2H-isoquinolin-1-one |
| InChIKey | IUIGIHBFESJYRB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CNC2=O)Br |
Computed by PubChem (NCBI)