Products 1207452-23-0
CAS 1207452-23-0 is the registry number for 2-Amino-1H-benzo(D)imidazole-5-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-3H-benzimidazole-5-carboxamide (CAS 1207452-23-0) is a chemical compound with the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. IUPAC name: 2-amino-3H-benzimidazole-5-carboxamide. InChIKey: MVZXAQTVSPDLMF-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | 2-amino-3H-benzimidazole-5-carboxamide |
| InChIKey | MVZXAQTVSPDLMF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)N)NC(=N2)N |
Computed by PubChem (NCBI)