CAS 1207989-76-1 is the registry number for 4-Iodomethyl benzoic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 4-(iodomethyl)benzoate (CAS 1207989-76-1) is a chemical compound with the molecular formula C12H15IO2 and a molecular weight of 318.15 g/mol. IUPAC name: tert-butyl 4-(iodomethyl)benzoate. InChIKey: NHZWMNUUKIDRQV-UHFFFAOYSA-N.
| Molecular formula | C12H15IO2 |
|---|---|
| Molecular weight | 318.15 g/mol |
| IUPAC name | tert-butyl 4-(iodomethyl)benzoate |
| InChIKey | NHZWMNUUKIDRQV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)CI |
Computed by PubChem (NCBI)