Products 1484816-22-9

CAS 1484816-22-9 is the registry number for 2-(4-Iodobenzyl)-3-methylbutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(4-iodophenyl)methyl]-3-methylbutanoic acid (CAS 1484816-22-9) is a chemical compound with the molecular formula C12H15IO2 and a molecular weight of 318.15 g/mol. IUPAC name: 2-[(4-iodophenyl)methyl]-3-methylbutanoic acid. InChIKey: GHRHQPDPPRHHEP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15IO2
Molecular weight318.15 g/mol
IUPAC name2-[(4-iodophenyl)methyl]-3-methylbutanoic acid
InChIKeyGHRHQPDPPRHHEP-UHFFFAOYSA-N
SMILESCC(C)C(CC1=CC=C(C=C1)I)C(=O)O

Computed by PubChem (NCBI)