Products 2098457-00-0

CAS 2098457-00-0 is the registry number for (Z)-2-Iodo-3-(4-methylbenzyl)but-2-ene-1,4-diol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2-iodo-3-[(4-methylphenyl)methyl]but-2-ene-1,4-diol (CAS 2098457-00-0) is a chemical compound with the molecular formula C12H15IO2 and a molecular weight of 318.15 g/mol. IUPAC name: 2-iodo-3-[(4-methylphenyl)methyl]but-2-ene-1,4-diol. InChIKey: GGCQNGWRTRCKJW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15IO2
Molecular weight318.15 g/mol
IUPAC name2-iodo-3-[(4-methylphenyl)methyl]but-2-ene-1,4-diol
InChIKeyGGCQNGWRTRCKJW-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)CC(=C(CO)I)CO

Computed by PubChem (NCBI)