Products 2504201-68-5

CAS 2504201-68-5 is the registry number for tert-Butyl 2-iodo-6-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-iodo-6-methylbenzoate (CAS 2504201-68-5) is a chemical compound with the molecular formula C12H15IO2 and a molecular weight of 318.15 g/mol. IUPAC name: tert-butyl 2-iodo-6-methylbenzoate. InChIKey: RYCSSBXVFYFLNA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15IO2
Molecular weight318.15 g/mol
IUPAC nametert-butyl 2-iodo-6-methylbenzoate
InChIKeyRYCSSBXVFYFLNA-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)I)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)