CAS 2504201-68-5 is the registry number for tert-Butyl 2-iodo-6-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 2-iodo-6-methylbenzoate (CAS 2504201-68-5) is a chemical compound with the molecular formula C12H15IO2 and a molecular weight of 318.15 g/mol. IUPAC name: tert-butyl 2-iodo-6-methylbenzoate. InChIKey: RYCSSBXVFYFLNA-UHFFFAOYSA-N.
| Molecular formula | C12H15IO2 |
|---|---|
| Molecular weight | 318.15 g/mol |
| IUPAC name | tert-butyl 2-iodo-6-methylbenzoate |
| InChIKey | RYCSSBXVFYFLNA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)I)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)