CAS 2101649-29-8 is the registry number for Methyl 3-(4-iodophenyl)-2,2-dimethylpropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(4-iodophenyl)-2,2-dimethylpropanoate (CAS 2101649-29-8) is a chemical compound with the molecular formula C12H15IO2 and a molecular weight of 318.15 g/mol. IUPAC name: methyl 3-(4-iodophenyl)-2,2-dimethylpropanoate. InChIKey: TXRWTYSKLIWJOB-UHFFFAOYSA-N.
| Molecular formula | C12H15IO2 |
|---|---|
| Molecular weight | 318.15 g/mol |
| IUPAC name | methyl 3-(4-iodophenyl)-2,2-dimethylpropanoate |
| InChIKey | TXRWTYSKLIWJOB-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=C(C=C1)I)C(=O)OC |
Computed by PubChem (NCBI)