Products 2101649-29-8

CAS 2101649-29-8 is the registry number for Methyl 3-(4-iodophenyl)-2,2-dimethylpropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-(4-iodophenyl)-2,2-dimethylpropanoate (CAS 2101649-29-8) is a chemical compound with the molecular formula C12H15IO2 and a molecular weight of 318.15 g/mol. IUPAC name: methyl 3-(4-iodophenyl)-2,2-dimethylpropanoate. InChIKey: TXRWTYSKLIWJOB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15IO2
Molecular weight318.15 g/mol
IUPAC namemethyl 3-(4-iodophenyl)-2,2-dimethylpropanoate
InChIKeyTXRWTYSKLIWJOB-UHFFFAOYSA-N
SMILESCC(C)(CC1=CC=C(C=C1)I)C(=O)OC

Computed by PubChem (NCBI)