Products 1208069-55-9
CAS 1208069-55-9 appears in our catalog under these names: 6-Chloro-3-iodo-2-methylimidazo(1,2-b)pyridazine, 6-Chloro-3-iodo-2-methylimidazo[1,2-b]pyridazine, 98%, 98%, 6-Chloro-3-iodo-2-methylimidazo[1,2-b]pyridazine, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
6-chloro-3-iodo-2-methylimidazo[1,2-b]pyridazine (CAS 1208069-55-9) is a chemical compound with the molecular formula C7H5ClIN3 and a molecular weight of 293.49 g/mol. IUPAC name: 6-chloro-3-iodo-2-methylimidazo[1,2-b]pyridazine. InChIKey: NVCVFLNSNUNJIC-UHFFFAOYSA-N.
| Molecular formula | C7H5ClIN3 |
|---|---|
| Molecular weight | 293.49 g/mol |
| IUPAC name | 6-chloro-3-iodo-2-methylimidazo[1,2-b]pyridazine |
| InChIKey | NVCVFLNSNUNJIC-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C(=N1)C=CC(=N2)Cl)I |
Computed by PubChem (NCBI)