CAS 1208075-82-4 is the registry number for 1-(2-Bromo-6-fluorophenyl)-2,2,2-trifluoroethanone, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
1-(2-bromo-6-fluorophenyl)-2,2,2-trifluoroethanone (CAS 1208075-82-4) is a chemical compound with the molecular formula C8H3BrF4O and a molecular weight of 271.01 g/mol. IUPAC name: 1-(2-bromo-6-fluorophenyl)-2,2,2-trifluoroethanone. InChIKey: VIAZLBYMYOENQS-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF4O |
|---|---|
| Molecular weight | 271.01 g/mol |
| IUPAC name | 1-(2-bromo-6-fluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | VIAZLBYMYOENQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)