CAS 1208081-60-0 appears in our catalog under these names: 2-Chloro-6-methylpyridine-3-sulfonyl chloride, 97%, 2-Chloro-6-methyl-pyridine-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-chloro-6-methylpyridine-3-sulfonyl chloride (CAS 1208081-60-0) is a chemical compound with the molecular formula C6H5Cl2NO2S and a molecular weight of 226.08 g/mol. IUPAC name: 2-chloro-6-methylpyridine-3-sulfonyl chloride. InChIKey: XFQBLBYYFLUHGZ-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO2S |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | 2-chloro-6-methylpyridine-3-sulfonyl chloride |
| InChIKey | XFQBLBYYFLUHGZ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)