Products 1208124-19-9
CAS 1208124-19-9 is the registry number for methyl 2,4-dichloro-5,6,7,8-tetrahydroquinazoline-6-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl 2,4-dichloro-5,6,7,8-tetrahydroquinazoline-6-carboxylate (CAS 1208124-19-9) is a chemical compound with the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.10 g/mol. IUPAC name: methyl 2,4-dichloro-5,6,7,8-tetrahydroquinazoline-6-carboxylate. InChIKey: QLDQMYDNFSGKBB-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2O2 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | methyl 2,4-dichloro-5,6,7,8-tetrahydroquinazoline-6-carboxylate |
| InChIKey | QLDQMYDNFSGKBB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCC2=C(C1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)