Products 1209-66-1
CAS 1209-66-1 appears in our catalog under these names: Phenothiazine S,S-Dioxide, Promethazine Impurity 15, Phenothiazine Dioxide, Phenothiazine S,S-Dioxide, >95% (HPLC), 10H-Phenothiazine 5,5-Dioxide, >95.0%(HPLC)(qNMR). Offered by: Chemat Brand, TRC, Biosynth, TCI, Ambeed. Available pack sizes: on request, 100mg, 1g, 500mg, 5000mg, 250mg, 5g, 25g.
10H-phenothiazine 5,5-dioxide (CAS 1209-66-1) is a chemical compound with the molecular formula C12H9NO2S and a molecular weight of 231.27 g/mol. IUPAC name: 10H-phenothiazine 5,5-dioxide. InChIKey: ZAYUOSICZWFJSW-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2S |
|---|---|
| Molecular weight | 231.27 g/mol |
| IUPAC name | 10H-phenothiazine 5,5-dioxide |
| InChIKey | ZAYUOSICZWFJSW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=CC=CC=C3S2(=O)=O |
Computed by PubChem (NCBI)